C20H17F4NO2 — CID 145269095
(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-(2,3,4,5-tetrafluoro-6-methylphenyl)methanone (PubChem CID 145269095) has the molecular formula C20H17F4NO2 and a molecular weight of 379.35 g/mol. Its IUPAC name is (6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-(2,3,4,5-tetrafluoro-6-methylphenyl)methanone.
| Compound Name | (6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-(2,3,4,5-tetrafluoro-6-methylphenyl)methanone |
|---|---|
| PubChem CID | 145269095 |
| Molecular Formula | C20H17F4NO2 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-(2,3,4,5-tetrafluoro-6-methylphenyl)methanone |
| SMILES | Cc1c(F)c(F)c(F)c(F)c1C(=O)c1cc2c3c(c1O)CCCN3CCC2 |
| InChI | InChI=1S/C20H17F4NO2/c1-9-13(15(22)17(24)16(23)14(9)21)20(27)12-8-10-4-2-6-25-7-3-5-11(18(10)25)19(12)26/h8,26H,2-7H2,1H3 |
| InChIKey | MJPCBLOLPPJPMU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|