C32H38N6 — CID 145269659
N'-[(E)-4-[2-(3-tert-butylphenyl)-4-[2-[(2S)-pyrrolidin-2-yl]-1H-imidazol-5-yl]phenyl]but-1-en-3-ynyl]pyrrolidine-2-carboximidamide (PubChem CID 145269659) has the molecular formula C32H38N6 and a molecular weight of 506.70 g/mol. Its IUPAC name is N'-[(E)-4-[2-(3-tert-butylphenyl)-4-[2-[(2S)-pyrrolidin-2-yl]-1H-imidazol-5-yl]phenyl]but-1-en-3-ynyl]pyrrolidine-2-carboximidamide.
| Compound Name | N'-[(E)-4-[2-(3-tert-butylphenyl)-4-[2-[(2S)-pyrrolidin-2-yl]-1H-imidazol-5-yl]phenyl]but-1-en-3-ynyl]pyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 145269659 |
| Molecular Formula | C32H38N6 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | N'-[(E)-4-[2-(3-tert-butylphenyl)-4-[2-[(2S)-pyrrolidin-2-yl]-1H-imidazol-5-yl]phenyl]but-1-en-3-ynyl]pyrrolidine-2-carboximidamide |
| SMILES | CC(C)(C)c1cccc(-c2cc(-c3cnc([C@@H]4CCCN4)[nH]3)ccc2C#C/C=C/N=C(\N)C2CCCN2)c1 |
| InChI | InChI=1S/C32H38N6/c1-32(2,3)25-11-6-10-23(19-25)26-20-24(29-21-37-31(38-29)28-13-8-18-35-28)15-14-22(26)9-4-5-16-36-30(33)27-12-7-17-34-27/h5-6,10-11,14-16,19-21,27-28,34-35H,7-8,12-13,17-18H2,1-3H3,(H2,33,36)(H,37,38)/b16-5+/t27?,28-/m0/s1 |
| InChIKey | DBKJBTXCJLRGBB-SHTVABNMSA-N |
| XLogP | 5.44 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|