C11H25BO3 — CID 145269779
ethane;4,4,5,5-tetramethyl-2-propoxy-1,3,2-dioxaborolane (PubChem CID 145269779) has the molecular formula C11H25BO3 and a molecular weight of 216.13 g/mol. Its IUPAC name is ethane;4,4,5,5-tetramethyl-2-propoxy-1,3,2-dioxaborolane.
| Compound Name | ethane;4,4,5,5-tetramethyl-2-propoxy-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145269779 |
| Molecular Formula | C11H25BO3 |
| Molecular Weight | 216.13 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | ethane;4,4,5,5-tetramethyl-2-propoxy-1,3,2-dioxaborolane |
| SMILES | CC.CCCOB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C9H19BO3.C2H6/c1-6-7-11-10-12-8(2,3)9(4,5)13-10;1-2/h6-7H2,1-5H3;1-2H3 |
| InChIKey | AXEJONUCTKVVCJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.13 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|