C17H15BrN4O2S — CID 145270029
6-bromo-N-[(2E)-4-methoxy-1-methyliminopenta-2,4-dien-2-yl]imidazo[2,1-b][1,3]benzothiazole-2-carboxamide (PubChem CID 145270029) has the molecular formula C17H15BrN4O2S and a molecular weight of 419.30 g/mol. Its IUPAC name is 6-bromo-N-[(2E)-4-methoxy-1-methyliminopenta-2,4-dien-2-yl]imidazo[2,1-b][1,3]benzothiazole-2-carboxamide.
| Compound Name | 6-bromo-N-[(2E)-4-methoxy-1-methyliminopenta-2,4-dien-2-yl]imidazo[2,1-b][1,3]benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 145270029 |
| Molecular Formula | C17H15BrN4O2S |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 6-bromo-N-[(2E)-4-methoxy-1-methyliminopenta-2,4-dien-2-yl]imidazo[2,1-b][1,3]benzothiazole-2-carboxamide |
| SMILES | C=C(/C=C(\C=N\C)NC(=O)c1cn2c(n1)sc1cc(Br)ccc12)OC |
| InChI | InChI=1S/C17H15BrN4O2S/c1-10(24-3)6-12(8-19-2)20-16(23)13-9-22-14-5-4-11(18)7-15(14)25-17(22)21-13/h4-9H,1H2,2-3H3,(H,20,23)/b12-6+,19-8+ |
| InChIKey | YVMGNEDLILYADB-IDNJTFJESA-N |
| XLogP | 3.79 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|