C26H30FNO7 — CID 145270444
(3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;ethyl 1-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxoquinoline-3-carboxylate;methanol (PubChem CID 145270444) has the molecular formula C26H30FNO7 and a molecular weight of 487.52 g/mol. Its IUPAC name is (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;ethyl 1-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxoquinoline-3-carboxylate;methanol.
| Compound Name | (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;ethyl 1-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxoquinoline-3-carboxylate;methanol |
|---|---|
| PubChem CID | 145270444 |
| Molecular Formula | C26H30FNO7 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;ethyl 1-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxoquinoline-3-carboxylate;methanol |
| SMILES | C1C[C@H]2OCC[C@H]2O1.CCOC(=O)c1c(O)c2ccccc2n(Cc2ccc(F)cc2)c1=O.CO |
| InChI | InChI=1S/C19H16FNO4.C6H10O2.CH4O/c1-2-25-19(24)16-17(22)14-5-3-4-6-15(14)21(18(16)23)11-12-7-9-13(20)10-8-12;1-3-7-6-2-4-8-5(1)6;1-2/h3-10,22H,2,11H2,1H3;5-6H,1-4H2;2H,1H3/t;5-,6-;/m.1./s1 |
| InChIKey | ZMYKKIBEXDBJHL-JGHXHLRYSA-N |
| XLogP | 3.24 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |