About anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile
anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile (PubChem CID 145270467) has the molecular formula C21H26N2O2
and a molecular weight of 338.45 g/mol. Its IUPAC name is anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile.
Molecular Properties
| Compound Name | anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile |
| PubChem CID | 145270467 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile |
| SMILES | COc1ccccc1.C[C@@]1(COc2cccc(C#N)c2)CCCNC1 |
| InChI | InChI=1S/C14H18N2O.C7H8O/c1-14(6-3-7-16-10-14)11-17-13-5-2-4-12(8-13)9-15;1-8-7-5-3-2-4-6-7/h2,4-5,8,16H,3,6-7,10-11H2,1H3;2-6H,1H3/t14-;/m1./s1 |
| InChIKey | WXLXKNISSQTFKP-PFEQFJNWSA-N |
| XLogP | 4.02 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile?
The IUPAC name of anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile (CID 145270467) is anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile.
What is the SMILES notation for anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile?
The canonical SMILES for anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile is COc1ccccc1.C[C@@]1(COc2cccc(C#N)c2)CCCNC1.
What is the InChIKey of anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile?
The InChIKey is WXLXKNISSQTFKP-PFEQFJNWSA-N. The full InChI is InChI=1S/C14H18N2O.C7H8O/c1-14(6-3-7-16-10-14)11-17-13-5-2-4-12(8-13)9-15;1-8-7-5-3-2-4-6-7/h2,4-5,8,16H,3,6-7,10-11H2,1H3;2-6H,1H3/t14-;/m1./s1.
What are the key properties of anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile?
anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile has a molecular weight of 338.45 g/mol, XLogP of 4.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;3-[[(3R)-3-methylpiperidin-3-yl]methoxy]benzonitrile is sourced from PubChem (CID 145270467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).