C20H32O4 — CID 14527073
[(3R,3aS,4S,8aS)-3-hydroxy-6,8a-dimethyl-8-oxo-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-azulen-4-yl] 3-methylbutanoate (PubChem CID 14527073) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is [(3R,3aS,4S,8aS)-3-hydroxy-6,8a-dimethyl-8-oxo-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-azulen-4-yl] 3-methylbutanoate.
| Compound Name | [(3R,3aS,4S,8aS)-3-hydroxy-6,8a-dimethyl-8-oxo-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-azulen-4-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 14527073 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [(3R,3aS,4S,8aS)-3-hydroxy-6,8a-dimethyl-8-oxo-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-azulen-4-yl] 3-methylbutanoate |
| SMILES | CC1=CC(=O)[C@@]2(C)CC[C@@](O)(C(C)C)[C@@H]2[C@@H](OC(=O)CC(C)C)C1 |
| InChI | InChI=1S/C20H32O4/c1-12(2)9-17(22)24-15-10-14(5)11-16(21)19(6)7-8-20(23,13(3)4)18(15)19/h11-13,15,18,23H,7-10H2,1-6H3/t15-,18+,19+,20+/m0/s1 |
| InChIKey | GAXAXYHMNNUEMY-YGWPLHOASA-N |
| XLogP | 3.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |