C17H27N3O2 — CID 145270781
1-benzyl-N-(2-methoxyethyl)-N-propan-2-ylpyrazol-3-amine;methanol (PubChem CID 145270781) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-benzyl-N-(2-methoxyethyl)-N-propan-2-ylpyrazol-3-amine;methanol.
| Compound Name | 1-benzyl-N-(2-methoxyethyl)-N-propan-2-ylpyrazol-3-amine;methanol |
|---|---|
| PubChem CID | 145270781 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 1-benzyl-N-(2-methoxyethyl)-N-propan-2-ylpyrazol-3-amine;methanol |
| SMILES | CO.COCCN(c1ccn(Cc2ccccc2)n1)C(C)C |
| InChI | InChI=1S/C16H23N3O.CH4O/c1-14(2)19(11-12-20-3)16-9-10-18(17-16)13-15-7-5-4-6-8-15;1-2/h4-10,14H,11-13H2,1-3H3;2H,1H3 |
| InChIKey | BGLXSKFUHJVIPE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |