C20H22N2O5 — CID 145271092
dimethylcarbamoyl 4-[(4-methoxyphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-6-carboxylate (PubChem CID 145271092) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is dimethylcarbamoyl 4-[(4-methoxyphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-6-carboxylate.
| Compound Name | dimethylcarbamoyl 4-[(4-methoxyphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-6-carboxylate |
|---|---|
| PubChem CID | 145271092 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | dimethylcarbamoyl 4-[(4-methoxyphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-6-carboxylate |
| SMILES | COc1ccc(CN2CCOc3ccc(C(=O)OC(=O)N(C)C)cc32)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-21(2)20(24)27-19(23)15-6-9-18-17(12-15)22(10-11-26-18)13-14-4-7-16(25-3)8-5-14/h4-9,12H,10-11,13H2,1-3H3 |
| InChIKey | RJNOJLKCUFBTFN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|