About ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+)
ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+) (PubChem CID 145271332) has the molecular formula C18H30BO3Rb
and a molecular weight of 390.72 g/mol. Its IUPAC name is ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+).
Molecular Properties
| Compound Name | ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+) |
| PubChem CID | 145271332 |
| Molecular Formula | C18H30BO3Rb |
| Molecular Weight | 390.72 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+) |
| SMILES | C/C=C\C(=C/CC)Oc1ccc(B([O-])OC)cc1.CC.CC.[Rb+] |
| InChI | InChI=1S/C14H18BO3.2C2H6.Rb/c1-4-6-13(7-5-2)18-14-10-8-12(9-11-14)15(16)17-3;2*1-2;/h4,6-11H,5H2,1-3H3;2*1-2H3;/q-1;;;+1/b6-4-,13-7+;;; |
| InChIKey | PEWLGEVRMHUYBE-CKXAAARKSA-N |
| XLogP | 0.69 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.72 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+)?
The IUPAC name of ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+) (CID 145271332) is ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+).
What is the SMILES notation for ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+)?
The canonical SMILES for ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+) is C/C=C\C(=C/CC)Oc1ccc(B([O-])OC)cc1.CC.CC.[Rb+].
What is the InChIKey of ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+)?
The InChIKey is PEWLGEVRMHUYBE-CKXAAARKSA-N. The full InChI is InChI=1S/C14H18BO3.2C2H6.Rb/c1-4-6-13(7-5-2)18-14-10-8-12(9-11-14)15(16)17-3;2*1-2;/h4,6-11H,5H2,1-3H3;2*1-2H3;/q-1;;;+1/b6-4-,13-7+;;;.
What are the key properties of ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+)?
ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+) has a molecular weight of 390.72 g/mol, XLogP of 0.69, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[4-[(2Z,4E)-hepta-2,4-dien-4-yl]oxyphenyl]-methoxyborinate;rubidium(1+) is sourced from PubChem (CID 145271332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).