About ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate
ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate (PubChem CID 145271464) has the molecular formula C16H28N2O2
and a molecular weight of 280.41 g/mol. Its IUPAC name is ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate.
Molecular Properties
| Compound Name | ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate |
| PubChem CID | 145271464 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate |
| SMILES | C=C/C=C(\C=C/CN1CCNCC1)C(=O)OCC.CC |
| InChI | InChI=1S/C14H22N2O2.C2H6/c1-3-6-13(14(17)18-4-2)7-5-10-16-11-8-15-9-12-16;1-2/h3,5-7,15H,1,4,8-12H2,2H3;1-2H3/b7-5-,13-6+; |
| InChIKey | DLSKBPHCJOQMAT-XTMQYXHHSA-N |
| XLogP | 2.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate?
The IUPAC name of ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate (CID 145271464) is ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate.
What is the SMILES notation for ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate?
The canonical SMILES for ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate is C=C/C=C(\C=C/CN1CCNCC1)C(=O)OCC.CC.
What is the InChIKey of ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate?
The InChIKey is DLSKBPHCJOQMAT-XTMQYXHHSA-N. The full InChI is InChI=1S/C14H22N2O2.C2H6/c1-3-6-13(14(17)18-4-2)7-5-10-16-11-8-15-9-12-16;1-2/h3,5-7,15H,1,4,8-12H2,2H3;1-2H3/b7-5-,13-6+;.
What are the key properties of ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate?
ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate has a molecular weight of 280.41 g/mol, XLogP of 2.15, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl (2E)-2-[(Z)-3-piperazin-1-ylprop-1-enyl]penta-2,4-dienoate is sourced from PubChem (CID 145271464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).