C17H22FN7O — CID 145272298
4-amino-N-[(Z)-1,3-diaminobut-2-enylidene]-7-(3-fluoro-3-methylcyclopentyl)pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 145272298) has the molecular formula C17H22FN7O and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-amino-N-[(Z)-1,3-diaminobut-2-enylidene]-7-(3-fluoro-3-methylcyclopentyl)pyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-N-[(Z)-1,3-diaminobut-2-enylidene]-7-(3-fluoro-3-methylcyclopentyl)pyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 145272298 |
| Molecular Formula | C17H22FN7O |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 4-amino-N-[(Z)-1,3-diaminobut-2-enylidene]-7-(3-fluoro-3-methylcyclopentyl)pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | C/C(N)=C/C(N)=N/C(=O)c1cn(C2CCC(C)(F)C2)c2ncnc(N)c12 |
| InChI | InChI=1S/C17H22FN7O/c1-9(19)5-12(20)24-16(26)11-7-25(10-3-4-17(2,18)6-10)15-13(11)14(21)22-8-23-15/h5,7-8,10H,3-4,6,19H2,1-2H3,(H2,20,24,26)(H2,21,22,23)/b9-5- |
| InChIKey | YSLMMZCCCRRSMH-UITAMQMPSA-N |
| XLogP | 1.83 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|