C15H24N8O — CID 145272311
2-[4-amino-6-(methylamino)pyrimidin-5-yl]-N-[(Z)-1,3-diaminobut-2-enylidene]-2-iminoacetamide;but-1-ene (PubChem CID 145272311) has the molecular formula C15H24N8O and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-[4-amino-6-(methylamino)pyrimidin-5-yl]-N-[(Z)-1,3-diaminobut-2-enylidene]-2-iminoacetamide;but-1-ene.
| Compound Name | 2-[4-amino-6-(methylamino)pyrimidin-5-yl]-N-[(Z)-1,3-diaminobut-2-enylidene]-2-iminoacetamide;but-1-ene |
|---|---|
| PubChem CID | 145272311 |
| Molecular Formula | C15H24N8O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-[4-amino-6-(methylamino)pyrimidin-5-yl]-N-[(Z)-1,3-diaminobut-2-enylidene]-2-iminoacetamide;but-1-ene |
| SMILES | C=CCC.[H]/N=C(\C(=O)/N=C(N)/C=C(/C)N)c1c(N)ncnc1NC |
| InChI | InChI=1S/C11H16N8O.C4H8/c1-5(12)3-6(13)19-11(20)8(14)7-9(15)17-4-18-10(7)16-2;1-3-4-2/h3-4,14H,12H2,1-2H3,(H2,13,19,20)(H3,15,16,17,18);3H,1,4H2,2H3/b5-3-,14-8-; |
| InChIKey | XNKYTAWPMJMLLX-YKLBZBBKSA-N |
| XLogP | 0.80 |
| TPSA | 169.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|