C8H11F2N — CID 145272368
3-(difluoromethyl)-1,6-dimethyl-2H-pyridine (PubChem CID 145272368) has the molecular formula C8H11F2N and a molecular weight of 159.18 g/mol. Its IUPAC name is 3-(difluoromethyl)-1,6-dimethyl-2H-pyridine.
| Compound Name | 3-(difluoromethyl)-1,6-dimethyl-2H-pyridine |
|---|---|
| PubChem CID | 145272368 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 3-(difluoromethyl)-1,6-dimethyl-2H-pyridine |
| SMILES | CC1=CC=C(C(F)F)CN1C |
| InChI | InChI=1S/C8H11F2N/c1-6-3-4-7(8(9)10)5-11(6)2/h3-4,8H,5H2,1-2H3 |
| InChIKey | DWOBNRAMYJGLFB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |