C17H21N — CID 145272702
5,5,6,6,10-pentamethylpyrrolo[2,1-a]isoquinoline (PubChem CID 145272702) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is 5,5,6,6,10-pentamethylpyrrolo[2,1-a]isoquinoline.
| Compound Name | 5,5,6,6,10-pentamethylpyrrolo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 145272702 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 5,5,6,6,10-pentamethylpyrrolo[2,1-a]isoquinoline |
| SMILES | Cc1cccc2c1-c1cccn1C(C)(C)C2(C)C |
| InChI | InChI=1S/C17H21N/c1-12-8-6-9-13-15(12)14-10-7-11-18(14)17(4,5)16(13,2)3/h6-11H,1-5H3 |
| InChIKey | SZZDMAIHUUHZMR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |