C24H31N3O4 — CID 145273574
methanol;2-methyl-2-[4-[3-[1-[(4-methylphenyl)methyl]-5-oxo-4H-1,2,4-triazol-3-yl]propyl]phenoxy]propanal (PubChem CID 145273574) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is methanol;2-methyl-2-[4-[3-[1-[(4-methylphenyl)methyl]-5-oxo-4H-1,2,4-triazol-3-yl]propyl]phenoxy]propanal.
| Compound Name | methanol;2-methyl-2-[4-[3-[1-[(4-methylphenyl)methyl]-5-oxo-4H-1,2,4-triazol-3-yl]propyl]phenoxy]propanal |
|---|---|
| PubChem CID | 145273574 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | methanol;2-methyl-2-[4-[3-[1-[(4-methylphenyl)methyl]-5-oxo-4H-1,2,4-triazol-3-yl]propyl]phenoxy]propanal |
| SMILES | CO.Cc1ccc(Cn2nc(CCCc3ccc(OC(C)(C)C=O)cc3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H27N3O3.CH4O/c1-17-7-9-19(10-8-17)15-26-22(28)24-21(25-26)6-4-5-18-11-13-20(14-12-18)29-23(2,3)16-27;1-2/h7-14,16H,4-6,15H2,1-3H3,(H,24,25,28);2H,1H3 |
| InChIKey | MIQNMOWBKJFTPD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|