About (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol
(3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol (PubChem CID 145273709) has the molecular formula C18H16F3NO4
and a molecular weight of 367.32 g/mol. Its IUPAC name is (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol.
Molecular Properties
| Compound Name | (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol |
| PubChem CID | 145273709 |
| Molecular Formula | C18H16F3NO4 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol |
| SMILES | OC1[C@@H](O)COC[C@@H]1N1c2ccccc2Oc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H16F3NO4/c19-18(20,21)10-5-6-16-12(7-10)22(11-3-1-2-4-15(11)26-16)13-8-25-9-14(23)17(13)24/h1-7,13-14,17,23-24H,8-9H2/t13-,14-,17?/m0/s1 |
| InChIKey | KBLZQILEIXLWML-CBVZESEGSA-N |
| XLogP | 3.07 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol?
The IUPAC name of (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol (CID 145273709) is (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol.
What is the SMILES notation for (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol?
The canonical SMILES for (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol is OC1[C@@H](O)COC[C@@H]1N1c2ccccc2Oc2ccc(C(F)(F)F)cc21.
What is the InChIKey of (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol?
The InChIKey is KBLZQILEIXLWML-CBVZESEGSA-N. The full InChI is InChI=1S/C18H16F3NO4/c19-18(20,21)10-5-6-16-12(7-10)22(11-3-1-2-4-15(11)26-16)13-8-25-9-14(23)17(13)24/h1-7,13-14,17,23-24H,8-9H2/t13-,14-,17?/m0/s1.
What are the key properties of (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol?
(3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol has a molecular weight of 367.32 g/mol, XLogP of 3.07, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-5-[2-(trifluoromethyl)phenoxazin-10-yl]oxane-3,4-diol is sourced from PubChem (CID 145273709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).