C26H35F2NO3 — CID 145274117
4-[2-[(3aR,5R)-6-methylidene-5-(1-prop-2-enoxyethenyl)-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2,5-difluoro-N,N-dimethylaniline;ethane (PubChem CID 145274117) has the molecular formula C26H35F2NO3 and a molecular weight of 447.57 g/mol. Its IUPAC name is 4-[2-[(3aR,5R)-6-methylidene-5-(1-prop-2-enoxyethenyl)-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2,5-difluoro-N,N-dimethylaniline;ethane.
| Compound Name | 4-[2-[(3aR,5R)-6-methylidene-5-(1-prop-2-enoxyethenyl)-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2,5-difluoro-N,N-dimethylaniline;ethane |
|---|---|
| PubChem CID | 145274117 |
| Molecular Formula | C26H35F2NO3 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 4-[2-[(3aR,5R)-6-methylidene-5-(1-prop-2-enoxyethenyl)-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2,5-difluoro-N,N-dimethylaniline;ethane |
| SMILES | C=CCOC(=C)[C@@H]1C[C@]2(C(C)Cc3cc(F)c(N(C)C)cc3F)OCOC2=CC1=C.CC |
| InChI | InChI=1S/C24H29F2NO3.C2H6/c1-7-8-28-17(4)19-13-24(23(9-15(19)2)29-14-30-24)16(3)10-18-11-21(26)22(27(5)6)12-20(18)25;1-2/h7,9,11-12,16,19H,1-2,4,8,10,13-14H2,3,5-6H3;1-2H3/t16?,19-,24-;/m1./s1 |
| InChIKey | OZJVLJXCIQXWCZ-MWISRSSPSA-N |
| XLogP | 6.16 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|