C20H26FN3O — CID 145274678
6-[(1S)-1-[4-(cyclobutylmethylidene)cyclohexyl]ethoxy]-4-fluoro-1H-indazol-3-amine (PubChem CID 145274678) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is 6-[(1S)-1-[4-(cyclobutylmethylidene)cyclohexyl]ethoxy]-4-fluoro-1H-indazol-3-amine.
| Compound Name | 6-[(1S)-1-[4-(cyclobutylmethylidene)cyclohexyl]ethoxy]-4-fluoro-1H-indazol-3-amine |
|---|---|
| PubChem CID | 145274678 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 6-[(1S)-1-[4-(cyclobutylmethylidene)cyclohexyl]ethoxy]-4-fluoro-1H-indazol-3-amine |
| SMILES | C[C@H](Oc1cc(F)c2c(N)n[nH]c2c1)C1CCC(=CC2CCC2)CC1 |
| InChI | InChI=1S/C20H26FN3O/c1-12(15-7-5-14(6-8-15)9-13-3-2-4-13)25-16-10-17(21)19-18(11-16)23-24-20(19)22/h9-13,15H,2-8H2,1H3,(H3,22,23,24)/b14-9-/t12-,15?/m0/s1 |
| InChIKey | UCMYYDDCSWILIA-RTNULICESA-N |
| XLogP | 4.97 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|