C36H42N8O2 — CID 145275099
N-[[4-[4-amino-1-(3-hydroxycyclopentyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]quinoline-8-carboxamide;(4Z)-hexa-1,4-diene;N-methylethanimine (PubChem CID 145275099) has the molecular formula C36H42N8O2 and a molecular weight of 618.79 g/mol. Its IUPAC name is N-[[4-[4-amino-1-(3-hydroxycyclopentyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]quinoline-8-carboxamide;(4Z)-hexa-1,4-diene;N-methylethanimine.
| Compound Name | N-[[4-[4-amino-1-(3-hydroxycyclopentyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]quinoline-8-carboxamide;(4Z)-hexa-1,4-diene;N-methylethanimine |
|---|---|
| PubChem CID | 145275099 |
| Molecular Formula | C36H42N8O2 |
| Molecular Weight | 618.79 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | N-[[4-[4-amino-1-(3-hydroxycyclopentyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]quinoline-8-carboxamide;(4Z)-hexa-1,4-diene;N-methylethanimine |
| SMILES | C/C=N/C.C=CC/C=C\C.Nc1ncnc2c1c(-c1ccc(CNC(=O)c3cccc4cccnc34)cc1)nn2C1CCC(O)C1 |
| InChI | InChI=1S/C27H25N7O2.C6H10.C3H7N/c28-25-22-24(33-34(26(22)32-15-31-25)19-10-11-20(35)13-19)18-8-6-16(7-9-18)14-30-27(36)21-5-1-3-17-4-2-12-29-23(17)21;1-3-5-6-4-2;1-3-4-2/h1-9,12,15,19-20,35H,10-11,13-14H2,(H,30,36)(H2,28,31,32);3-4,6H,1,5H2,2H3;3H,1-2H3/b;6-4-;4-3+ |
| InChIKey | RFTWTRYXOGDKNX-WNMGETPVSA-N |
| XLogP | 6.49 |
| TPSA | 144.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.79 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|