About ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole
ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 145275498) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole.
Molecular Properties
| Compound Name | ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole |
| PubChem CID | 145275498 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | CC.Cc1cn2ncsc2n1 |
| InChI | InChI=1S/C5H5N3S.C2H6/c1-4-2-8-5(7-4)9-3-6-8;1-2/h2-3H,1H3;1-2H3 |
| InChIKey | PZDDLTKANYDSLW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole?
The IUPAC name of ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole (CID 145275498) is ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole.
What is the SMILES notation for ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole?
The canonical SMILES for ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole is CC.Cc1cn2ncsc2n1.
What is the InChIKey of ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole?
The InChIKey is PZDDLTKANYDSLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3S.C2H6/c1-4-2-8-5(7-4)9-3-6-8;1-2/h2-3H,1H3;1-2H3.
What are the key properties of ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole?
ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole has a molecular weight of 169.25 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methylimidazo[2,1-b][1,3,4]thiadiazole is sourced from PubChem (CID 145275498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).