C51H58N4 — CID 145276209
2-N,7-N-bis[5-methyl-5-(3-methylpentan-3-yl)cyclohepta-1,3,6-trien-1-yl]-2-N,7-N-dipyridin-3-yl-9H-fluorene-2,7-diamine (PubChem CID 145276209) has the molecular formula C51H58N4 and a molecular weight of 727.05 g/mol. Its IUPAC name is 2-N,7-N-bis[5-methyl-5-(3-methylpentan-3-yl)cyclohepta-1,3,6-trien-1-yl]-2-N,7-N-dipyridin-3-yl-9H-fluorene-2,7-diamine.
| Compound Name | 2-N,7-N-bis[5-methyl-5-(3-methylpentan-3-yl)cyclohepta-1,3,6-trien-1-yl]-2-N,7-N-dipyridin-3-yl-9H-fluorene-2,7-diamine |
|---|---|
| PubChem CID | 145276209 |
| Molecular Formula | C51H58N4 |
| Molecular Weight | 727.05 g/mol |
| Exact Mass | 726.47 |
| IUPAC Name | 2-N,7-N-bis[5-methyl-5-(3-methylpentan-3-yl)cyclohepta-1,3,6-trien-1-yl]-2-N,7-N-dipyridin-3-yl-9H-fluorene-2,7-diamine |
| SMILES | CCC(C)(CC)C1(C)C=CC=C(N(c2cccnc2)c2ccc3c(c2)Cc2cc(N(C4=CC=CC(C)(C(C)(CC)CC)C=C4)c4cccnc4)ccc2-3)C=C1 |
| InChI | InChI=1S/C51H58N4/c1-9-48(5,10-2)50(7)27-13-17-40(25-29-50)54(44-19-15-31-52-36-44)42-21-23-46-38(34-42)33-39-35-43(22-24-47(39)46)55(45-20-16-32-53-37-45)41-18-14-28-51(8,30-26-41)49(6,11-3)12-4/h13-32,34-37H,9-12,33H2,1-8H3 |
| InChIKey | IQXWBAWWTQFZHP-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.05 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |