C23H17NO — CID 145276960
5-[(1Z)-buta-1,3-dienyl]-6-methyl-7-oxa-14-azapentacyclo[11.7.0.03,11.04,8.015,20]icosa-1(13),2,4(8),5,9,11,15,17,19-nonaene (PubChem CID 145276960) has the molecular formula C23H17NO and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-6-methyl-7-oxa-14-azapentacyclo[11.7.0.03,11.04,8.015,20]icosa-1(13),2,4(8),5,9,11,15,17,19-nonaene.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-6-methyl-7-oxa-14-azapentacyclo[11.7.0.03,11.04,8.015,20]icosa-1(13),2,4(8),5,9,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 145276960 |
| Molecular Formula | C23H17NO |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-6-methyl-7-oxa-14-azapentacyclo[11.7.0.03,11.04,8.015,20]icosa-1(13),2,4(8),5,9,11,15,17,19-nonaene |
| SMILES | C=C/C=C\c1c(C)oc2ccc3cc4[nH]c5ccccc5c4cc3c12 |
| InChI | InChI=1S/C23H17NO/c1-3-4-7-16-14(2)25-22-11-10-15-12-21-19(13-18(15)23(16)22)17-8-5-6-9-20(17)24-21/h3-13,24H,1H2,2H3/b7-4- |
| InChIKey | ZEVCMXPLYOFPJN-DAXSKMNVSA-N |
| XLogP | 6.73 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|