C11H15N3O2 — CID 14527703
3-N,4-N-diethylpyridine-3,4-dicarboxamide (PubChem CID 14527703) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-N,4-N-diethylpyridine-3,4-dicarboxamide.
| Compound Name | 3-N,4-N-diethylpyridine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 14527703 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-N,4-N-diethylpyridine-3,4-dicarboxamide |
| SMILES | CCNC(=O)c1ccncc1C(=O)NCC |
| InChI | InChI=1S/C11H15N3O2/c1-3-13-10(15)8-5-6-12-7-9(8)11(16)14-4-2/h5-7H,3-4H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | IMVVRBNLCUUWKO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |