C38H28F2N4 — CID 145277086
8-[9,9-difluoro-7-(4-methyl-4,6-diphenyl-1H-1,3,5-triazin-2-yl)fluoren-2-yl]-4a,5-dihydroquinoline (PubChem CID 145277086) has the molecular formula C38H28F2N4 and a molecular weight of 578.67 g/mol. Its IUPAC name is 8-[9,9-difluoro-7-(4-methyl-4,6-diphenyl-1H-1,3,5-triazin-2-yl)fluoren-2-yl]-4a,5-dihydroquinoline.
| Compound Name | 8-[9,9-difluoro-7-(4-methyl-4,6-diphenyl-1H-1,3,5-triazin-2-yl)fluoren-2-yl]-4a,5-dihydroquinoline |
|---|---|
| PubChem CID | 145277086 |
| Molecular Formula | C38H28F2N4 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 8-[9,9-difluoro-7-(4-methyl-4,6-diphenyl-1H-1,3,5-triazin-2-yl)fluoren-2-yl]-4a,5-dihydroquinoline |
| SMILES | CC1(c2ccccc2)N=C(c2ccccc2)NC(c2ccc3c(c2)C(F)(F)c2cc(C4=C5N=CC=CC5CC=C4)ccc2-3)=N1 |
| InChI | InChI=1S/C38H28F2N4/c1-37(28-14-6-3-7-15-28)43-35(25-10-4-2-5-11-25)42-36(44-37)27-18-20-31-30-19-17-26(22-32(30)38(39,40)33(31)23-27)29-16-8-12-24-13-9-21-41-34(24)29/h2-11,13-24H,12H2,1H3,(H,42,43,44) |
| InChIKey | HPQBYJRCWYMVJQ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |