C56H40FN3 — CID 145277089
2-[6-(9,9-diphenyl-7,8-dihydrofluoren-2-yl)-9-fluoro-9-prop-1-en-2-ylfluoren-3-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 145277089) has the molecular formula C56H40FN3 and a molecular weight of 773.96 g/mol. Its IUPAC name is 2-[6-(9,9-diphenyl-7,8-dihydrofluoren-2-yl)-9-fluoro-9-prop-1-en-2-ylfluoren-3-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[6-(9,9-diphenyl-7,8-dihydrofluoren-2-yl)-9-fluoro-9-prop-1-en-2-ylfluoren-3-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 145277089 |
| Molecular Formula | C56H40FN3 |
| Molecular Weight | 773.96 g/mol |
| Exact Mass | 773.32 |
| IUPAC Name | 2-[6-(9,9-diphenyl-7,8-dihydrofluoren-2-yl)-9-fluoro-9-prop-1-en-2-ylfluoren-3-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C=C(C)C1(F)c2ccc(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)C3=C4C=CCC3)cc2-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C56H40FN3/c1-36(2)56(57)49-31-28-39(40-27-30-45-44-25-15-16-26-48(44)55(51(45)35-40,42-21-11-5-12-22-42)43-23-13-6-14-24-43)33-46(49)47-34-41(29-32-50(47)56)54-59-52(37-17-7-3-8-18-37)58-53(60-54)38-19-9-4-10-20-38/h3-15,17-25,27-35H,1,16,26H2,2H3 |
| InChIKey | WEYVRURRQPHPLU-UHFFFAOYSA-N |
| XLogP | 13.76 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.96 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|