About 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide
2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide (PubChem CID 145277289) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide.
Molecular Properties
| Compound Name | 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide |
| PubChem CID | 145277289 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide |
| SMILES | C=C/C=C\C(CNC(=O)C(C)CCC)=N/C |
| InChI | InChI=1S/C13H22N2O/c1-5-7-9-12(14-4)10-15-13(16)11(3)8-6-2/h5,7,9,11H,1,6,8,10H2,2-4H3,(H,15,16)/b9-7-,14-12+ |
| InChIKey | SFUKGKLEAGSIBI-LTPFSSFFSA-N |
| XLogP | 2.35 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide?
The IUPAC name of 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide (CID 145277289) is 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide.
What is the SMILES notation for 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide?
The canonical SMILES for 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide is C=C/C=C\C(CNC(=O)C(C)CCC)=N/C.
What is the InChIKey of 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide?
The InChIKey is SFUKGKLEAGSIBI-LTPFSSFFSA-N. The full InChI is InChI=1S/C13H22N2O/c1-5-7-9-12(14-4)10-15-13(16)11(3)8-6-2/h5,7,9,11H,1,6,8,10H2,2-4H3,(H,15,16)/b9-7-,14-12+.
What are the key properties of 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide?
2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide has a molecular weight of 222.33 g/mol, XLogP of 2.35, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(3Z)-2-methyliminohexa-3,5-dienyl]pentanamide is sourced from PubChem (CID 145277289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).