C10H11FN2S — CID 145277402
[2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-1,3-thiazol-5-yl]methanamine (PubChem CID 145277402) has the molecular formula C10H11FN2S and a molecular weight of 210.28 g/mol. Its IUPAC name is [2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 145277402 |
| Molecular Formula | C10H11FN2S |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | [2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-1,3-thiazol-5-yl]methanamine |
| SMILES | C=C(F)/C=C\C(=C)c1ncc(CN)s1 |
| InChI | InChI=1S/C10H11FN2S/c1-7(3-4-8(2)11)10-13-6-9(5-12)14-10/h3-4,6H,1-2,5,12H2/b4-3- |
| InChIKey | ORMCGFXQGIUVDJ-ARJAWSKDSA-N |
| XLogP | 2.65 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|