C12H13ClN2O2S — CID 145277537
N-[[2-[(2E,4E)-5-chloro-6-hydroxyhepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methyl]formamide (PubChem CID 145277537) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is N-[[2-[(2E,4E)-5-chloro-6-hydroxyhepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methyl]formamide.
| Compound Name | N-[[2-[(2E,4E)-5-chloro-6-hydroxyhepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 145277537 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | N-[[2-[(2E,4E)-5-chloro-6-hydroxyhepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methyl]formamide |
| SMILES | C=C(O)/C(Cl)=C\C(=C/C)c1ncc(CNC=O)s1 |
| InChI | InChI=1S/C12H13ClN2O2S/c1-3-9(4-11(13)8(2)17)12-15-6-10(18-12)5-14-7-16/h3-4,6-7,17H,2,5H2,1H3,(H,14,16)/b9-3+,11-4+ |
| InChIKey | POZWKKXKJFEWHQ-FSCUZGFYSA-N |
| XLogP | 2.99 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|