C28H30N4O4S — CID 145277551
N-[[2-[(2E,4Z)-6-(2-aminoethoxy)hepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methyl]-4-(2-formylphenoxy)-3-(methylamino)benzamide (PubChem CID 145277551) has the molecular formula C28H30N4O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is N-[[2-[(2E,4Z)-6-(2-aminoethoxy)hepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methyl]-4-(2-formylphenoxy)-3-(methylamino)benzamide.
| Compound Name | N-[[2-[(2E,4Z)-6-(2-aminoethoxy)hepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methyl]-4-(2-formylphenoxy)-3-(methylamino)benzamide |
|---|---|
| PubChem CID | 145277551 |
| Molecular Formula | C28H30N4O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | N-[[2-[(2E,4Z)-6-(2-aminoethoxy)hepta-2,4,6-trien-3-yl]-1,3-thiazol-5-yl]methyl]-4-(2-formylphenoxy)-3-(methylamino)benzamide |
| SMILES | C=C(/C=C\C(=C/C)c1ncc(CNC(=O)c2ccc(Oc3ccccc3C=O)c(NC)c2)s1)OCCN |
| InChI | InChI=1S/C28H30N4O4S/c1-4-20(10-9-19(2)35-14-13-29)28-32-17-23(37-28)16-31-27(34)21-11-12-26(24(15-21)30-3)36-25-8-6-5-7-22(25)18-33/h4-12,15,17-18,30H,2,13-14,16,29H2,1,3H3,(H,31,34)/b10-9-,20-4+ |
| InChIKey | NENCYLMBNXRSJU-GRFYROJPSA-N |
| XLogP | 5.17 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|