C12H14N2OS — CID 145277641
(2E,3Z)-1-[5-(aminomethyl)-1,3-thiazol-2-yl]-2-ethylidenehexa-3,5-dien-1-one (PubChem CID 145277641) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is (2E,3Z)-1-[5-(aminomethyl)-1,3-thiazol-2-yl]-2-ethylidenehexa-3,5-dien-1-one.
| Compound Name | (2E,3Z)-1-[5-(aminomethyl)-1,3-thiazol-2-yl]-2-ethylidenehexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 145277641 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (2E,3Z)-1-[5-(aminomethyl)-1,3-thiazol-2-yl]-2-ethylidenehexa-3,5-dien-1-one |
| SMILES | C=C/C=C\C(=C/C)C(=O)c1ncc(CN)s1 |
| InChI | InChI=1S/C12H14N2OS/c1-3-5-6-9(4-2)11(15)12-14-8-10(7-13)16-12/h3-6,8H,1,7,13H2,2H3/b6-5-,9-4+ |
| InChIKey | GWSZXNPOKMVLCC-CXBDEZGUSA-N |
| XLogP | 2.47 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|