About 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane
2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane (PubChem CID 145277764) has the molecular formula C9H14N4O
and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane.
Molecular Properties
| Compound Name | 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane |
| PubChem CID | 145277764 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane |
| SMILES | CC.CC1C=Nc2c1nc(N)[nH]c2=O |
| InChI | InChI=1S/C7H8N4O.C2H6/c1-3-2-9-5-4(3)10-7(8)11-6(5)12;1-2/h2-3H,1H3,(H3,8,10,11,12);1-2H3 |
| InChIKey | MLVXLCZTGRJBPX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane?
The IUPAC name of 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane (CID 145277764) is 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane.
What is the SMILES notation for 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane?
The canonical SMILES for 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane is CC.CC1C=Nc2c1nc(N)[nH]c2=O.
What is the InChIKey of 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane?
The InChIKey is MLVXLCZTGRJBPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O.C2H6/c1-3-2-9-5-4(3)10-7(8)11-6(5)12;1-2/h2-3H,1H3,(H3,8,10,11,12);1-2H3.
What are the key properties of 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane?
2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane has a molecular weight of 194.24 g/mol, XLogP of 1.20, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7-methyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one;ethane is sourced from PubChem (CID 145277764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).