C13H16O3S — CID 14527810
S-benzyl (4R)-5,5-dideuterio-2,2-dimethyl-1,3-dioxolane-4-carbothioate (PubChem CID 14527810) has the molecular formula C13H16O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is S-benzyl (4R)-5,5-dideuterio-2,2-dimethyl-1,3-dioxolane-4-carbothioate.
| Compound Name | S-benzyl (4R)-5,5-dideuterio-2,2-dimethyl-1,3-dioxolane-4-carbothioate |
|---|---|
| PubChem CID | 14527810 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | S-benzyl (4R)-5,5-dideuterio-2,2-dimethyl-1,3-dioxolane-4-carbothioate |
| SMILES | [2H]C1([2H])OC(C)(C)O[C@H]1C(=O)SCc1ccccc1 |
| InChI | InChI=1S/C13H16O3S/c1-13(2)15-8-11(16-13)12(14)17-9-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3/t11-/m1/s1/i8D2 |
| InChIKey | FNOOTXUARTXWGX-BAMYJXGYSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|