C9H18N2 — CID 145278570
(Z)-3-N-methylidenepent-2-ene-1,3-diimine;propane (PubChem CID 145278570) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (Z)-3-N-methylidenepent-2-ene-1,3-diimine;propane.
| Compound Name | (Z)-3-N-methylidenepent-2-ene-1,3-diimine;propane |
|---|---|
| PubChem CID | 145278570 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (Z)-3-N-methylidenepent-2-ene-1,3-diimine;propane |
| SMILES | CCC.[H]/N=C/C=C(/CC)N=C |
| InChI | InChI=1S/C6H10N2.C3H8/c1-3-6(8-2)4-5-7;1-3-2/h4-5,7H,2-3H2,1H3;3H2,1-2H3/b6-4-,7-5+; |
| InChIKey | WWBKGGFYFOVUOB-ZMVRXXEHSA-N |
| XLogP | 3.05 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|