C20H20Cl2N2O4 — CID 145278728
1-N-[(2,6-dichlorophenyl)methyl]-2-formyl-4-N-(2-methoxyethyl)-1-N-methylbenzene-1,4-dicarboxamide (PubChem CID 145278728) has the molecular formula C20H20Cl2N2O4 and a molecular weight of 423.30 g/mol. Its IUPAC name is 1-N-[(2,6-dichlorophenyl)methyl]-2-formyl-4-N-(2-methoxyethyl)-1-N-methylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[(2,6-dichlorophenyl)methyl]-2-formyl-4-N-(2-methoxyethyl)-1-N-methylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 145278728 |
| Molecular Formula | C20H20Cl2N2O4 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 1-N-[(2,6-dichlorophenyl)methyl]-2-formyl-4-N-(2-methoxyethyl)-1-N-methylbenzene-1,4-dicarboxamide |
| SMILES | COCCNC(=O)c1ccc(C(=O)N(C)Cc2c(Cl)cccc2Cl)c(C=O)c1 |
| InChI | InChI=1S/C20H20Cl2N2O4/c1-24(11-16-17(21)4-3-5-18(16)22)20(27)15-7-6-13(10-14(15)12-25)19(26)23-8-9-28-2/h3-7,10,12H,8-9,11H2,1-2H3,(H,23,26) |
| InChIKey | AUEUUJANRBNNRS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|