C41H48F3N7O4 — CID 145278862
7-(6,7-dimethoxyquinolin-4-yl)oxy-N-[4-[4-(methylamino)piperidin-1-yl]-3-(trifluoromethyl)phenyl]quinazolin-2-amine;3-(1-methylpiperidin-2-yl)propanal (PubChem CID 145278862) has the molecular formula C41H48F3N7O4 and a molecular weight of 759.87 g/mol. Its IUPAC name is 7-(6,7-dimethoxyquinolin-4-yl)oxy-N-[4-[4-(methylamino)piperidin-1-yl]-3-(trifluoromethyl)phenyl]quinazolin-2-amine;3-(1-methylpiperidin-2-yl)propanal.
| Compound Name | 7-(6,7-dimethoxyquinolin-4-yl)oxy-N-[4-[4-(methylamino)piperidin-1-yl]-3-(trifluoromethyl)phenyl]quinazolin-2-amine;3-(1-methylpiperidin-2-yl)propanal |
|---|---|
| PubChem CID | 145278862 |
| Molecular Formula | C41H48F3N7O4 |
| Molecular Weight | 759.87 g/mol |
| Exact Mass | 759.37 |
| IUPAC Name | 7-(6,7-dimethoxyquinolin-4-yl)oxy-N-[4-[4-(methylamino)piperidin-1-yl]-3-(trifluoromethyl)phenyl]quinazolin-2-amine;3-(1-methylpiperidin-2-yl)propanal |
| SMILES | CN1CCCCC1CCC=O.CNC1CCN(c2ccc(Nc3ncc4ccc(Oc5ccnc6cc(OC)c(OC)cc56)cc4n3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C32H31F3N6O3.C9H17NO/c1-36-20-9-12-41(13-10-20)27-7-5-21(14-24(27)32(33,34)35)39-31-38-18-19-4-6-22(15-25(19)40-31)44-28-8-11-37-26-17-30(43-3)29(42-2)16-23(26)28;1-10-7-3-2-5-9(10)6-4-8-11/h4-8,11,14-18,20,36H,9-10,12-13H2,1-3H3,(H,38,39,40);8-9H,2-7H2,1H3 |
| InChIKey | JRDZBORGVDZYEB-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.87 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|