About formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate
formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate (PubChem CID 145279110) has the molecular formula C22H25NO5
and a molecular weight of 383.44 g/mol. Its IUPAC name is formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate.
Molecular Properties
| Compound Name | formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate |
| PubChem CID | 145279110 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate |
| SMILES | C/C=C/c1cc(N(C)/C(=C/C)c2ccccc2OC=O)ccc1OC.O=CO |
| InChI | InChI=1S/C21H23NO3.CH2O2/c1-5-9-16-14-17(12-13-20(16)24-4)22(3)19(6-2)18-10-7-8-11-21(18)25-15-23;2-1-3/h5-15H,1-4H3;1H,(H,2,3)/b9-5+,19-6+; |
| InChIKey | HDIIQQPIHXWOAJ-OGTXARBPSA-N |
| XLogP | 4.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate?
The IUPAC name of formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate (CID 145279110) is formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate.
What is the SMILES notation for formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate?
The canonical SMILES for formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate is C/C=C/c1cc(N(C)/C(=C/C)c2ccccc2OC=O)ccc1OC.O=CO.
What is the InChIKey of formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate?
The InChIKey is HDIIQQPIHXWOAJ-OGTXARBPSA-N. The full InChI is InChI=1S/C21H23NO3.CH2O2/c1-5-9-16-14-17(12-13-20(16)24-4)22(3)19(6-2)18-10-7-8-11-21(18)25-15-23;2-1-3/h5-15H,1-4H3;1H,(H,2,3)/b9-5+,19-6+;.
What are the key properties of formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate?
formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate has a molecular weight of 383.44 g/mol, XLogP of 4.46, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;[2-[(E)-1-[4-methoxy-N-methyl-3-[(E)-prop-1-enyl]anilino]prop-1-enyl]phenyl] formate is sourced from PubChem (CID 145279110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).