C15H15F3O3S — CID 145279237
(4Z)-1,1,1-trifluoro-3-methylidene-6-(4-methylsulfonylcyclohexa-1,3-dien-1-yl)hepta-4,6-dien-2-one (PubChem CID 145279237) has the molecular formula C15H15F3O3S and a molecular weight of 332.34 g/mol. Its IUPAC name is (4Z)-1,1,1-trifluoro-3-methylidene-6-(4-methylsulfonylcyclohexa-1,3-dien-1-yl)hepta-4,6-dien-2-one.
| Compound Name | (4Z)-1,1,1-trifluoro-3-methylidene-6-(4-methylsulfonylcyclohexa-1,3-dien-1-yl)hepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 145279237 |
| Molecular Formula | C15H15F3O3S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (4Z)-1,1,1-trifluoro-3-methylidene-6-(4-methylsulfonylcyclohexa-1,3-dien-1-yl)hepta-4,6-dien-2-one |
| SMILES | C=C(/C=C\C(=C)C1=CC=C(S(C)(=O)=O)CC1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H15F3O3S/c1-10(4-5-11(2)14(19)15(16,17)18)12-6-8-13(9-7-12)22(3,20)21/h4-6,8H,1-2,7,9H2,3H3/b5-4- |
| InChIKey | VOLLMWMCSRWVHH-PLNGDYQASA-N |
| XLogP | 3.44 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|