C11H19F2IN2O — CID 145279425
4-[2-(4,4-difluoropiperidin-3-yl)ethyl]-2-iodomorpholine (PubChem CID 145279425) has the molecular formula C11H19F2IN2O and a molecular weight of 360.19 g/mol. Its IUPAC name is 4-[2-(4,4-difluoropiperidin-3-yl)ethyl]-2-iodomorpholine.
| Compound Name | 4-[2-(4,4-difluoropiperidin-3-yl)ethyl]-2-iodomorpholine |
|---|---|
| PubChem CID | 145279425 |
| Molecular Formula | C11H19F2IN2O |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 4-[2-(4,4-difluoropiperidin-3-yl)ethyl]-2-iodomorpholine |
| SMILES | FC1(F)CCNCC1CCN1CCOC(I)C1 |
| InChI | InChI=1S/C11H19F2IN2O/c12-11(13)2-3-15-7-9(11)1-4-16-5-6-17-10(14)8-16/h9-10,15H,1-8H2 |
| InChIKey | WJRTVMCXJCCMHP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|