C44H29F2N3 — CID 145280823
4-[5-(4-cyano-6-methylcyclohexa-1,3-dien-1-yl)-2,4-bis[4-(4-fluorophenyl)phenyl]-3-iminocyclopenta-1,4-dien-1-yl]benzonitrile (PubChem CID 145280823) has the molecular formula C44H29F2N3 and a molecular weight of 637.73 g/mol. Its IUPAC name is 4-[5-(4-cyano-6-methylcyclohexa-1,3-dien-1-yl)-2,4-bis[4-(4-fluorophenyl)phenyl]-3-iminocyclopenta-1,4-dien-1-yl]benzonitrile.
| Compound Name | 4-[5-(4-cyano-6-methylcyclohexa-1,3-dien-1-yl)-2,4-bis[4-(4-fluorophenyl)phenyl]-3-iminocyclopenta-1,4-dien-1-yl]benzonitrile |
|---|---|
| PubChem CID | 145280823 |
| Molecular Formula | C44H29F2N3 |
| Molecular Weight | 637.73 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | 4-[5-(4-cyano-6-methylcyclohexa-1,3-dien-1-yl)-2,4-bis[4-(4-fluorophenyl)phenyl]-3-iminocyclopenta-1,4-dien-1-yl]benzonitrile |
| SMILES | [H]/N=C1/C(c2ccc(-c3ccc(F)cc3)cc2)=C(C2=CC=C(C#N)CC2C)C(c2ccc(C#N)cc2)=C1c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C44H29F2N3/c1-27-24-29(26-48)4-23-39(27)43-40(34-5-2-28(25-47)3-6-34)41(35-11-7-30(8-12-35)32-15-19-37(45)20-16-32)44(49)42(43)36-13-9-31(10-14-36)33-17-21-38(46)22-18-33/h2-23,27,49H,24H2,1H3/b49-44+ |
| InChIKey | JEQDFIWAMWGPLR-NRTURQFVSA-N |
| XLogP | 10.98 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.73 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|