C21H19NO4 — CID 14528090
(10-acetyloxy-6-methyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate (PubChem CID 14528090) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is (10-acetyloxy-6-methyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate.
| Compound Name | (10-acetyloxy-6-methyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate |
|---|---|
| PubChem CID | 14528090 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (10-acetyloxy-6-methyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CC(C)n1c-2cc2cc(OC(C)=O)ccc21 |
| InChI | InChI=1S/C21H19NO4/c1-12-8-15-9-17(25-13(2)23)4-6-19(15)21-11-16-10-18(26-14(3)24)5-7-20(16)22(12)21/h4-7,9-12H,8H2,1-3H3 |
| InChIKey | NNXKAJLZJJAFPV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|