About (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate
(10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate (PubChem CID 14528091) has the molecular formula C22H21NO4
and a molecular weight of 363.41 g/mol. Its IUPAC name is (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate.
Molecular Properties
| Compound Name | (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate |
| PubChem CID | 14528091 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate |
| SMILES | CCC1Cc2cc(OC(C)=O)ccc2-c2cc3cc(OC(C)=O)ccc3n21 |
| InChI | InChI=1S/C22H21NO4/c1-4-17-9-15-10-18(26-13(2)24)5-7-20(15)22-12-16-11-19(27-14(3)25)6-8-21(16)23(17)22/h5-8,10-12,17H,4,9H2,1-3H3 |
| InChIKey | WGGAULMDUIDUGU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate?
The IUPAC name of (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate (CID 14528091) is (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate.
What is the SMILES notation for (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate?
The canonical SMILES for (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate is CCC1Cc2cc(OC(C)=O)ccc2-c2cc3cc(OC(C)=O)ccc3n21.
What is the InChIKey of (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate?
The InChIKey is WGGAULMDUIDUGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO4/c1-4-17-9-15-10-18(26-13(2)24)5-7-20(15)22-12-16-11-19(27-14(3)25)6-8-21(16)23(17)22/h5-8,10-12,17H,4,9H2,1-3H3.
What are the key properties of (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate?
(10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate has a molecular weight of 363.41 g/mol, XLogP of 4.67, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (10-acetyloxy-6-ethyl-5,6-dihydroindolo[2,1-a]isoquinolin-3-yl) acetate is sourced from PubChem (CID 14528091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).