C39H38B2N2O4 — CID 145280953
3-[3-[3-[3-(1,5-dimethyl-2,4-dioxa-3-borabicyclo[3.1.0]hexan-3-yl)-5-pyridin-3-ylphenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 145280953) has the molecular formula C39H38B2N2O4 and a molecular weight of 620.37 g/mol. Its IUPAC name is 3-[3-[3-[3-(1,5-dimethyl-2,4-dioxa-3-borabicyclo[3.1.0]hexan-3-yl)-5-pyridin-3-ylphenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 3-[3-[3-[3-(1,5-dimethyl-2,4-dioxa-3-borabicyclo[3.1.0]hexan-3-yl)-5-pyridin-3-ylphenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 145280953 |
| Molecular Formula | C39H38B2N2O4 |
| Molecular Weight | 620.37 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | 3-[3-[3-[3-(1,5-dimethyl-2,4-dioxa-3-borabicyclo[3.1.0]hexan-3-yl)-5-pyridin-3-ylphenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | CC1(C)OB(c2cc(-c3cccnc3)cc(-c3cccc(-c4cc(B5OC6(C)CC6(C)O5)cc(-c5cccnc5)c4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C39H38B2N2O4/c1-36(2)37(3,4)45-40(44-36)34-19-30(17-32(21-34)28-12-8-14-42-23-28)26-10-7-11-27(16-26)31-18-33(29-13-9-15-43-24-29)22-35(20-31)41-46-38(5)25-39(38,6)47-41/h7-24H,25H2,1-6H3 |
| InChIKey | RQPUWHZPLFXKIL-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.37 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|