C23H29NO2 — CID 145280980
(2E)-3-cyclopentyl-1-(9,9-dimethyl-3,4,8,8a-tetrahydrofluoren-2-yl)-2-hydroxyiminopropan-1-one (PubChem CID 145280980) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (2E)-3-cyclopentyl-1-(9,9-dimethyl-3,4,8,8a-tetrahydrofluoren-2-yl)-2-hydroxyiminopropan-1-one.
| Compound Name | (2E)-3-cyclopentyl-1-(9,9-dimethyl-3,4,8,8a-tetrahydrofluoren-2-yl)-2-hydroxyiminopropan-1-one |
|---|---|
| PubChem CID | 145280980 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (2E)-3-cyclopentyl-1-(9,9-dimethyl-3,4,8,8a-tetrahydrofluoren-2-yl)-2-hydroxyiminopropan-1-one |
| SMILES | CC1(C)C2=C(CCC(C(=O)/C(CC3CCCC3)=N/O)=C2)C2=CC=CCC21 |
| InChI | InChI=1S/C23H29NO2/c1-23(2)19-10-6-5-9-17(19)18-12-11-16(14-20(18)23)22(25)21(24-26)13-15-7-3-4-8-15/h5-6,9,14-15,19,26H,3-4,7-8,10-13H2,1-2H3/b24-21+ |
| InChIKey | YAMSRDFPQBNRBK-DARPEHSRSA-N |
| XLogP | 5.53 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|