C8H15NO2 — CID 145281201
4,5-dimethyl-3,6-dihydro-1,3-oxazin-2-one;ethane (PubChem CID 145281201) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 4,5-dimethyl-3,6-dihydro-1,3-oxazin-2-one;ethane.
| Compound Name | 4,5-dimethyl-3,6-dihydro-1,3-oxazin-2-one;ethane |
|---|---|
| PubChem CID | 145281201 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 4,5-dimethyl-3,6-dihydro-1,3-oxazin-2-one;ethane |
| SMILES | CC.CC1=C(C)NC(=O)OC1 |
| InChI | InChI=1S/C6H9NO2.C2H6/c1-4-3-9-6(8)7-5(4)2;1-2/h3H2,1-2H3,(H,7,8);1-2H3 |
| InChIKey | SPQVHPITEZXKFW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |