About (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen
(Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen (PubChem CID 145282388) has the molecular formula C12H27N3O
and a molecular weight of 229.37 g/mol. Its IUPAC name is (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen.
Molecular Properties
| Compound Name | (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen |
| PubChem CID | 145282388 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen |
| SMILES | CC(=O)NCC(C)C.[H]/N=C(C)/C=C\CNC.[H][H] |
| InChI | InChI=1S/C6H12N2.C6H13NO.H2/c1-6(7)4-3-5-8-2;1-5(2)4-7-6(3)8;/h3-4,7-8H,5H2,1-2H3;5H,4H2,1-3H3,(H,7,8);1H/b4-3-,7-6+;; |
| InChIKey | FPBRLGDCGLNFRG-LYTRGJKYSA-N |
| XLogP | 1.83 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen?
The IUPAC name of (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen (CID 145282388) is (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen.
What is the SMILES notation for (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen?
The canonical SMILES for (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen is CC(=O)NCC(C)C.[H]/N=C(C)/C=C\CNC.[H][H].
What is the InChIKey of (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen?
The InChIKey is FPBRLGDCGLNFRG-LYTRGJKYSA-N. The full InChI is InChI=1S/C6H12N2.C6H13NO.H2/c1-6(7)4-3-5-8-2;1-5(2)4-7-6(3)8;/h3-4,7-8H,5H2,1-2H3;5H,4H2,1-3H3,(H,7,8);1H/b4-3-,7-6+;;.
What are the key properties of (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen?
(Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen has a molecular weight of 229.37 g/mol, XLogP of 1.83, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-imino-N-methylpent-2-en-1-amine;N-(2-methylpropyl)acetamide;molecular hydrogen is sourced from PubChem (CID 145282388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).