C27H29ClN2O4 — CID 145282973
(3R)-3-(4-chlorophenyl)-6-(2-hydroxypropan-2-yl)-3-(3-hydroxypropoxy)-2-[(5-methyl-2-pyridinyl)methyl]isoindol-1-one (PubChem CID 145282973) has the molecular formula C27H29ClN2O4 and a molecular weight of 480.99 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-6-(2-hydroxypropan-2-yl)-3-(3-hydroxypropoxy)-2-[(5-methyl-2-pyridinyl)methyl]isoindol-1-one.
| Compound Name | (3R)-3-(4-chlorophenyl)-6-(2-hydroxypropan-2-yl)-3-(3-hydroxypropoxy)-2-[(5-methyl-2-pyridinyl)methyl]isoindol-1-one |
|---|---|
| PubChem CID | 145282973 |
| Molecular Formula | C27H29ClN2O4 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-6-(2-hydroxypropan-2-yl)-3-(3-hydroxypropoxy)-2-[(5-methyl-2-pyridinyl)methyl]isoindol-1-one |
| SMILES | Cc1ccc(CN2C(=O)c3cc(C(C)(C)O)ccc3[C@]2(OCCCO)c2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C27H29ClN2O4/c1-18-5-11-22(29-16-18)17-30-25(32)23-15-20(26(2,3)33)8-12-24(23)27(30,34-14-4-13-31)19-6-9-21(28)10-7-19/h5-12,15-16,31,33H,4,13-14,17H2,1-3H3/t27-/m1/s1 |
| InChIKey | XOALLEUQPUCQDM-HHHXNRCGSA-N |
| XLogP | 4.53 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|