C31H32Cl2FNO5 — CID 145283274
N-[(4-chlorophenyl)-[2-fluoro-4-[hydroxy(oxan-4-yl)methyl]-6-methylphenyl]-hydroxymethyl]-N-[(2S)-1-(4-chlorophenyl)-2-methyl-3-oxopropyl]formamide (PubChem CID 145283274) has the molecular formula C31H32Cl2FNO5 and a molecular weight of 588.50 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-[2-fluoro-4-[hydroxy(oxan-4-yl)methyl]-6-methylphenyl]-hydroxymethyl]-N-[(2S)-1-(4-chlorophenyl)-2-methyl-3-oxopropyl]formamide.
| Compound Name | N-[(4-chlorophenyl)-[2-fluoro-4-[hydroxy(oxan-4-yl)methyl]-6-methylphenyl]-hydroxymethyl]-N-[(2S)-1-(4-chlorophenyl)-2-methyl-3-oxopropyl]formamide |
|---|---|
| PubChem CID | 145283274 |
| Molecular Formula | C31H32Cl2FNO5 |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | N-[(4-chlorophenyl)-[2-fluoro-4-[hydroxy(oxan-4-yl)methyl]-6-methylphenyl]-hydroxymethyl]-N-[(2S)-1-(4-chlorophenyl)-2-methyl-3-oxopropyl]formamide |
| SMILES | Cc1cc(C(O)C2CCOCC2)cc(F)c1C(O)(c1ccc(Cl)cc1)N(C=O)C(c1ccc(Cl)cc1)[C@H](C)C=O |
| InChI | InChI=1S/C31H32Cl2FNO5/c1-19-15-23(30(38)22-11-13-40-14-12-22)16-27(34)28(19)31(39,24-5-9-26(33)10-6-24)35(18-37)29(20(2)17-36)21-3-7-25(32)8-4-21/h3-10,15-18,20,22,29-30,38-39H,11-14H2,1-2H3/t20-,29?,30?,31?/m1/s1 |
| InChIKey | QDTAHYBCLCIICU-OEYSXSLJSA-N |
| XLogP | 6.13 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|