About 7,8-diazabicyclo[4.2.0]octa-2,4-diene
7,8-diazabicyclo[4.2.0]octa-2,4-diene (PubChem CID 145284196) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 7,8-diazabicyclo[4.2.0]octa-2,4-diene.
Molecular Properties
| Compound Name | 7,8-diazabicyclo[4.2.0]octa-2,4-diene |
| PubChem CID | 145284196 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 7,8-diazabicyclo[4.2.0]octa-2,4-diene |
| SMILES | C1=CC2NNC2C=C1 |
| InChI | InChI=1S/C6H8N2/c1-2-4-6-5(3-1)7-8-6/h1-8H |
| InChIKey | UNZJNEOBUQUMEB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-diazabicyclo[4.2.0]octa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-diazabicyclo[4.2.0]octa-2,4-diene?
The IUPAC name of 7,8-diazabicyclo[4.2.0]octa-2,4-diene (CID 145284196) is 7,8-diazabicyclo[4.2.0]octa-2,4-diene.
What is the SMILES notation for 7,8-diazabicyclo[4.2.0]octa-2,4-diene?
The canonical SMILES for 7,8-diazabicyclo[4.2.0]octa-2,4-diene is C1=CC2NNC2C=C1.
What is the InChIKey of 7,8-diazabicyclo[4.2.0]octa-2,4-diene?
The InChIKey is UNZJNEOBUQUMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2/c1-2-4-6-5(3-1)7-8-6/h1-8H.
What are the key properties of 7,8-diazabicyclo[4.2.0]octa-2,4-diene?
7,8-diazabicyclo[4.2.0]octa-2,4-diene has a molecular weight of 108.14 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-diazabicyclo[4.2.0]octa-2,4-diene is sourced from PubChem (CID 145284196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).