C32H35FN4O5S2 — CID 145284748
(NZ)-N-[2-(4,4-dimethylcyclohexyl)sulfonyl-7-[4-(2-fluoro-3-methanimidoylphenyl)piperazin-1-yl]sulfonylfluoren-9-ylidene]hydroxylamine (PubChem CID 145284748) has the molecular formula C32H35FN4O5S2 and a molecular weight of 638.79 g/mol. Its IUPAC name is (NZ)-N-[2-(4,4-dimethylcyclohexyl)sulfonyl-7-[4-(2-fluoro-3-methanimidoylphenyl)piperazin-1-yl]sulfonylfluoren-9-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2-(4,4-dimethylcyclohexyl)sulfonyl-7-[4-(2-fluoro-3-methanimidoylphenyl)piperazin-1-yl]sulfonylfluoren-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 145284748 |
| Molecular Formula | C32H35FN4O5S2 |
| Molecular Weight | 638.79 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | (NZ)-N-[2-(4,4-dimethylcyclohexyl)sulfonyl-7-[4-(2-fluoro-3-methanimidoylphenyl)piperazin-1-yl]sulfonylfluoren-9-ylidene]hydroxylamine |
| SMILES | [H]/N=C/c1cccc(N2CCN(S(=O)(=O)c3ccc4c(c3)/C(=N\O)c3cc(S(=O)(=O)C5CCC(C)(C)CC5)ccc3-4)CC2)c1F |
| InChI | InChI=1S/C32H35FN4O5S2/c1-32(2)12-10-22(11-13-32)43(39,40)23-6-8-25-26-9-7-24(19-28(26)31(35-38)27(25)18-23)44(41,42)37-16-14-36(15-17-37)29-5-3-4-21(20-34)30(29)33/h3-9,18-20,22,34,38H,10-17H2,1-2H3/b34-20+,35-31- |
| InChIKey | QOEKFFHVPSJHMB-KREMDDQUSA-N |
| XLogP | 5.28 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.79 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|